About 3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione
3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione (PubChem CID 64882259) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione.
Molecular Properties
| Compound Name | 3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione |
| PubChem CID | 64882259 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione |
| SMILES | CN1CCC(=O)NC(C(C)(C)C)C1=O |
| InChI | InChI=1S/C10H18N2O2/c1-10(2,3)8-9(14)12(4)6-5-7(13)11-8/h8H,5-6H2,1-4H3,(H,11,13) |
| InChIKey | NJQBODYAONFDRC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione?
The IUPAC name of 3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione (CID 64882259) is 3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione.
What is the SMILES notation for 3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione?
The canonical SMILES for 3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione is CN1CCC(=O)NC(C(C)(C)C)C1=O.
What is the InChIKey of 3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione?
The InChIKey is NJQBODYAONFDRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-10(2,3)8-9(14)12(4)6-5-7(13)11-8/h8H,5-6H2,1-4H3,(H,11,13).
What are the key properties of 3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione?
3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione has a molecular weight of 198.27 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1-methyl-1,4-diazepane-2,5-dione is sourced from PubChem (CID 64882259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).