About 1-(2-methoxyethyl)-1,4-diazepane-2,5-dione
1-(2-methoxyethyl)-1,4-diazepane-2,5-dione (PubChem CID 64882784) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-1,4-diazepane-2,5-dione.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-1,4-diazepane-2,5-dione |
| PubChem CID | 64882784 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-(2-methoxyethyl)-1,4-diazepane-2,5-dione |
| SMILES | COCCN1CCC(=O)NCC1=O |
| InChI | InChI=1S/C8H14N2O3/c1-13-5-4-10-3-2-7(11)9-6-8(10)12/h2-6H2,1H3,(H,9,11) |
| InChIKey | XZMUSTNAWWBBMJ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-methoxyethyl)-1,4-diazepane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-1,4-diazepane-2,5-dione?
The IUPAC name of 1-(2-methoxyethyl)-1,4-diazepane-2,5-dione (CID 64882784) is 1-(2-methoxyethyl)-1,4-diazepane-2,5-dione.
What is the SMILES notation for 1-(2-methoxyethyl)-1,4-diazepane-2,5-dione?
The canonical SMILES for 1-(2-methoxyethyl)-1,4-diazepane-2,5-dione is COCCN1CCC(=O)NCC1=O.
What is the InChIKey of 1-(2-methoxyethyl)-1,4-diazepane-2,5-dione?
The InChIKey is XZMUSTNAWWBBMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-13-5-4-10-3-2-7(11)9-6-8(10)12/h2-6H2,1H3,(H,9,11).
What are the key properties of 1-(2-methoxyethyl)-1,4-diazepane-2,5-dione?
1-(2-methoxyethyl)-1,4-diazepane-2,5-dione has a molecular weight of 186.21 g/mol, XLogP of -1.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-1,4-diazepane-2,5-dione is sourced from PubChem (CID 64882784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).