C13H21F3N2O3 — CID 64882810
3,3,7-trimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-diazepane-2,5-dione (PubChem CID 64882810) has the molecular formula C13H21F3N2O3 and a molecular weight of 310.32 g/mol. Its IUPAC name is 3,3,7-trimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-diazepane-2,5-dione.
| Compound Name | 3,3,7-trimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64882810 |
| Molecular Formula | C13H21F3N2O3 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3,3,7-trimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-diazepane-2,5-dione |
| SMILES | CC1CC(=O)NC(C)(C)C(=O)N1CCCOCC(F)(F)F |
| InChI | InChI=1S/C13H21F3N2O3/c1-9-7-10(19)17-12(2,3)11(20)18(9)5-4-6-21-8-13(14,15)16/h9H,4-8H2,1-3H3,(H,17,19) |
| InChIKey | BYVPPAZNYNDMIG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|