About methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate
methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate (PubChem CID 648832) has the molecular formula C13H12N2O5S
and a molecular weight of 308.31 g/mol. Its IUPAC name is methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate.
Molecular Properties
| Compound Name | methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate |
| PubChem CID | 648832 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CN2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C13H12N2O5S/c1-20-12(18)8-2-4-9(5-3-8)14-10(16)6-15-11(17)7-21-13(15)19/h2-5H,6-7H2,1H3,(H,14,16) |
| InChIKey | JHBAEKMUGKUYII-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate?
The IUPAC name of methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate (CID 648832) is methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate.
What is the SMILES notation for methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate?
The canonical SMILES for methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate is COC(=O)c1ccc(NC(=O)CN2C(=O)CSC2=O)cc1.
What is the InChIKey of methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate?
The InChIKey is JHBAEKMUGKUYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O5S/c1-20-12(18)8-2-4-9(5-3-8)14-10(16)6-15-11(17)7-21-13(15)19/h2-5H,6-7H2,1H3,(H,14,16).
What are the key properties of methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate?
methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate has a molecular weight of 308.31 g/mol, XLogP of 1.11, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]benzoate is sourced from PubChem (CID 648832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).