About 3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione
3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione (PubChem CID 64883688) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione.
Molecular Properties
| Compound Name | 3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione |
| PubChem CID | 64883688 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione |
| SMILES | CCC(C)C1NC(=O)C2(CCCCC2)NC1=O |
| InChI | InChI=1S/C13H22N2O2/c1-3-9(2)10-11(16)15-13(12(17)14-10)7-5-4-6-8-13/h9-10H,3-8H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | FHZNTFJWYSQHDC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione?
The IUPAC name of 3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione (CID 64883688) is 3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione.
What is the SMILES notation for 3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione?
The canonical SMILES for 3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione is CCC(C)C1NC(=O)C2(CCCCC2)NC1=O.
What is the InChIKey of 3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione?
The InChIKey is FHZNTFJWYSQHDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-3-9(2)10-11(16)15-13(12(17)14-10)7-5-4-6-8-13/h9-10H,3-8H2,1-2H3,(H,14,17)(H,15,16).
What are the key properties of 3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione?
3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione has a molecular weight of 238.33 g/mol, XLogP of 1.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-1,4-diazaspiro[5.5]undecane-2,5-dione is sourced from PubChem (CID 64883688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).