C11H24N2 — CID 64884451
2,2-diethyl-5-propan-2-ylpiperazine (PubChem CID 64884451) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 2,2-diethyl-5-propan-2-ylpiperazine.
| Compound Name | 2,2-diethyl-5-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 64884451 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 2,2-diethyl-5-propan-2-ylpiperazine |
| SMILES | CCC1(CC)CNC(C(C)C)CN1 |
| InChI | InChI=1S/C11H24N2/c1-5-11(6-2)8-12-10(7-13-11)9(3)4/h9-10,12-13H,5-8H2,1-4H3 |
| InChIKey | DBGPWDKEJBYDLQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |