About 8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione
8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 64886104) has the molecular formula C17H30N2O2
and a molecular weight of 294.44 g/mol. Its IUPAC name is 8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione.
Molecular Properties
| Compound Name | 8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione |
| PubChem CID | 64886104 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | CCCCCCCCN1C(=O)C2(CCCC2)NC(=O)C1C |
| InChI | InChI=1S/C17H30N2O2/c1-3-4-5-6-7-10-13-19-14(2)15(20)18-17(16(19)21)11-8-9-12-17/h14H,3-13H2,1-2H3,(H,18,20) |
| InChIKey | UJFGDPFBYHWMSA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione?
The IUPAC name of 8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione (CID 64886104) is 8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione.
What is the SMILES notation for 8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione?
The canonical SMILES for 8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione is CCCCCCCCN1C(=O)C2(CCCC2)NC(=O)C1C.
What is the InChIKey of 8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione?
The InChIKey is UJFGDPFBYHWMSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O2/c1-3-4-5-6-7-10-13-19-14(2)15(20)18-17(16(19)21)11-8-9-12-17/h14H,3-13H2,1-2H3,(H,18,20).
What are the key properties of 8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione?
8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione has a molecular weight of 294.44 g/mol, XLogP of 3.01, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-9-octyl-6,9-diazaspiro[4.5]decane-7,10-dione is sourced from PubChem (CID 64886104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).