C15H21BrN2O2S — CID 64887113
1-[(3-bromothiophen-2-yl)methyl]-3,3,6-triethylpiperazine-2,5-dione (PubChem CID 64887113) has the molecular formula C15H21BrN2O2S and a molecular weight of 373.32 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)methyl]-3,3,6-triethylpiperazine-2,5-dione.
| Compound Name | 1-[(3-bromothiophen-2-yl)methyl]-3,3,6-triethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64887113 |
| Molecular Formula | C15H21BrN2O2S |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)methyl]-3,3,6-triethylpiperazine-2,5-dione |
| SMILES | CCC1C(=O)NC(CC)(CC)C(=O)N1Cc1sccc1Br |
| InChI | InChI=1S/C15H21BrN2O2S/c1-4-11-13(19)17-15(5-2,6-3)14(20)18(11)9-12-10(16)7-8-21-12/h7-8,11H,4-6,9H2,1-3H3,(H,17,19) |
| InChIKey | WWFZFAUHVWZJSP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |