C11H17F3N2O3 — CID 64888148
4-amino-5-oxo-5-[3-(trifluoromethyl)piperidin-1-yl]pentanoic acid (PubChem CID 64888148) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is 4-amino-5-oxo-5-[3-(trifluoromethyl)piperidin-1-yl]pentanoic acid.
| Compound Name | 4-amino-5-oxo-5-[3-(trifluoromethyl)piperidin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 64888148 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-amino-5-oxo-5-[3-(trifluoromethyl)piperidin-1-yl]pentanoic acid |
| SMILES | NC(CCC(=O)O)C(=O)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H17F3N2O3/c12-11(13,14)7-2-1-5-16(6-7)10(19)8(15)3-4-9(17)18/h7-8H,1-6,15H2,(H,17,18) |
| InChIKey | RURBGXWBPUJIAY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |