C11H11N3O7 — CID 64888318
3-(2,4-dinitroanilino)oxolane-3-carboxylic acid (PubChem CID 64888318) has the molecular formula C11H11N3O7 and a molecular weight of 297.22 g/mol. Its IUPAC name is 3-(2,4-dinitroanilino)oxolane-3-carboxylic acid.
| Compound Name | 3-(2,4-dinitroanilino)oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 64888318 |
| Molecular Formula | C11H11N3O7 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 3-(2,4-dinitroanilino)oxolane-3-carboxylic acid |
| SMILES | O=C(O)C1(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CCOC1 |
| InChI | InChI=1S/C11H11N3O7/c15-10(16)11(3-4-21-6-11)12-8-2-1-7(13(17)18)5-9(8)14(19)20/h1-2,5,12H,3-4,6H2,(H,15,16) |
| InChIKey | YBRKVMGHLQQCAQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 144.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|