C13H17NO4S — CID 64888611
3-[(5-ethyl-4-methylthiophene-2-carbonyl)amino]oxolane-3-carboxylic acid (PubChem CID 64888611) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 3-[(5-ethyl-4-methylthiophene-2-carbonyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 3-[(5-ethyl-4-methylthiophene-2-carbonyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 64888611 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3-[(5-ethyl-4-methylthiophene-2-carbonyl)amino]oxolane-3-carboxylic acid |
| SMILES | CCc1sc(C(=O)NC2(C(=O)O)CCOC2)cc1C |
| InChI | InChI=1S/C13H17NO4S/c1-3-9-8(2)6-10(19-9)11(15)14-13(12(16)17)4-5-18-7-13/h6H,3-5,7H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | VJYSETNBKNQPJT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |