C12H11F2N3O2 — CID 64888824
3-[3-(3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine (PubChem CID 64888824) has the molecular formula C12H11F2N3O2 and a molecular weight of 267.24 g/mol. Its IUPAC name is 3-[3-(3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine.
| Compound Name | 3-[3-(3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine |
|---|---|
| PubChem CID | 64888824 |
| Molecular Formula | C12H11F2N3O2 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 3-[3-(3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine |
| SMILES | NC1(c2nc(-c3ccc(F)c(F)c3)no2)CCOC1 |
| InChI | InChI=1S/C12H11F2N3O2/c13-8-2-1-7(5-9(8)14)10-16-11(19-17-10)12(15)3-4-18-6-12/h1-2,5H,3-4,6,15H2 |
| InChIKey | KEQPEYHQVSBYKM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |