C12H18N4O4 — CID 64889268
3-(3-imidazol-1-ylpropylcarbamoylamino)oxolane-3-carboxylic acid (PubChem CID 64889268) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-(3-imidazol-1-ylpropylcarbamoylamino)oxolane-3-carboxylic acid.
| Compound Name | 3-(3-imidazol-1-ylpropylcarbamoylamino)oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 64889268 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3-(3-imidazol-1-ylpropylcarbamoylamino)oxolane-3-carboxylic acid |
| SMILES | O=C(NCCCn1ccnc1)NC1(C(=O)O)CCOC1 |
| InChI | InChI=1S/C12H18N4O4/c17-10(18)12(2-7-20-8-12)15-11(19)14-3-1-5-16-6-4-13-9-16/h4,6,9H,1-3,5,7-8H2,(H,17,18)(H2,14,15,19) |
| InChIKey | QAUTVCJCKNFULX-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|