C11H15N3O4 — CID 64889450
3-[(6-ethoxypyrazin-2-yl)amino]oxolane-3-carboxylic acid (PubChem CID 64889450) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-[(6-ethoxypyrazin-2-yl)amino]oxolane-3-carboxylic acid.
| Compound Name | 3-[(6-ethoxypyrazin-2-yl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 64889450 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-[(6-ethoxypyrazin-2-yl)amino]oxolane-3-carboxylic acid |
| SMILES | CCOc1cncc(NC2(C(=O)O)CCOC2)n1 |
| InChI | InChI=1S/C11H15N3O4/c1-2-18-9-6-12-5-8(13-9)14-11(10(15)16)3-4-17-7-11/h5-6H,2-4,7H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | OINHLDZPLGNRLM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |