About [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate
[2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate (PubChem CID 6489078) has the molecular formula C18H17NO5
and a molecular weight of 327.34 g/mol. Its IUPAC name is [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate.
Molecular Properties
| Compound Name | [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate |
| PubChem CID | 6489078 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(C2NC(=O)c3ccccc3O2)cc1OC |
| InChI | InChI=1S/C18H17NO5/c1-3-16(20)23-14-9-8-11(10-15(14)22-2)18-19-17(21)12-6-4-5-7-13(12)24-18/h4-10,18H,3H2,1-2H3,(H,19,21) |
| InChIKey | HPEPSLOUIAHRIC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate?
The IUPAC name of [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate (CID 6489078) is [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate.
What is the SMILES notation for [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate?
The canonical SMILES for [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate is CCC(=O)Oc1ccc(C2NC(=O)c3ccccc3O2)cc1OC.
What is the InChIKey of [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate?
The InChIKey is HPEPSLOUIAHRIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO5/c1-3-16(20)23-14-9-8-11(10-15(14)22-2)18-19-17(21)12-6-4-5-7-13(12)24-18/h4-10,18H,3H2,1-2H3,(H,19,21).
What are the key properties of [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate?
[2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate has a molecular weight of 327.34 g/mol, XLogP of 2.83, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] propanoate is sourced from PubChem (CID 6489078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).