C19H19NO5 — CID 6489089
[2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] butanoate (PubChem CID 6489089) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] butanoate.
| Compound Name | [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] butanoate |
|---|---|
| PubChem CID | 6489089 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [2-methoxy-4-(4-oxo-2,3-dihydro-1,3-benzoxazin-2-yl)phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(C2NC(=O)c3ccccc3O2)cc1OC |
| InChI | InChI=1S/C19H19NO5/c1-3-6-17(21)24-15-10-9-12(11-16(15)23-2)19-20-18(22)13-7-4-5-8-14(13)25-19/h4-5,7-11,19H,3,6H2,1-2H3,(H,20,22) |
| InChIKey | LMYKVWZXWLGRLD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|