C10H15NO4S — CID 64890928
3-(thiolane-2-carbonylamino)oxolane-3-carboxylic acid (PubChem CID 64890928) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is 3-(thiolane-2-carbonylamino)oxolane-3-carboxylic acid.
| Compound Name | 3-(thiolane-2-carbonylamino)oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 64890928 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-(thiolane-2-carbonylamino)oxolane-3-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCOC1)C1CCCS1 |
| InChI | InChI=1S/C10H15NO4S/c12-8(7-2-1-5-16-7)11-10(9(13)14)3-4-15-6-10/h7H,1-6H2,(H,11,12)(H,13,14) |
| InChIKey | VVAHERZROQZCFF-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |