C13H17N3O4 — CID 64891125
3-amino-N-[3-(2-amino-2-oxoethoxy)phenyl]oxolane-3-carboxamide (PubChem CID 64891125) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-amino-N-[3-(2-amino-2-oxoethoxy)phenyl]oxolane-3-carboxamide.
| Compound Name | 3-amino-N-[3-(2-amino-2-oxoethoxy)phenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 64891125 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-amino-N-[3-(2-amino-2-oxoethoxy)phenyl]oxolane-3-carboxamide |
| SMILES | NC(=O)COc1cccc(NC(=O)C2(N)CCOC2)c1 |
| InChI | InChI=1S/C13H17N3O4/c14-11(17)7-20-10-3-1-2-9(6-10)16-12(18)13(15)4-5-19-8-13/h1-3,6H,4-5,7-8,15H2,(H2,14,17)(H,16,18) |
| InChIKey | UEHLMYAVGBZSJU-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |