About methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate
methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate (PubChem CID 648917) has the molecular formula C15H14N2O2S
and a molecular weight of 286.36 g/mol. Its IUPAC name is methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate.
Molecular Properties
| Compound Name | methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate |
| PubChem CID | 648917 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate |
| SMILES | COC(=O)CSc1nc2cc(C)cc(C)c2cc1C#N |
| InChI | InChI=1S/C15H14N2O2S/c1-9-4-10(2)12-6-11(7-16)15(17-13(12)5-9)20-8-14(18)19-3/h4-6H,8H2,1-3H3 |
| InChIKey | ZKPARJRYOCRTBT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate?
The IUPAC name of methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate (CID 648917) is methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate.
What is the SMILES notation for methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate?
The canonical SMILES for methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate is COC(=O)CSc1nc2cc(C)cc(C)c2cc1C#N.
What is the InChIKey of methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate?
The InChIKey is ZKPARJRYOCRTBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2S/c1-9-4-10(2)12-6-11(7-16)15(17-13(12)5-9)20-8-14(18)19-3/h4-6H,8H2,1-3H3.
What are the key properties of methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate?
methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate has a molecular weight of 286.36 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-cyano-5,7-dimethylquinolin-2-yl)sulfanylacetate is sourced from PubChem (CID 648917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).