C14H19N3O — CID 648921
[4-(dimethylamino)phenyl]-(1-ethylimidazol-2-yl)methanol (PubChem CID 648921) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is [4-(dimethylamino)phenyl]-(1-ethylimidazol-2-yl)methanol.
| Compound Name | [4-(dimethylamino)phenyl]-(1-ethylimidazol-2-yl)methanol |
|---|---|
| PubChem CID | 648921 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | [4-(dimethylamino)phenyl]-(1-ethylimidazol-2-yl)methanol |
| SMILES | CCn1ccnc1C(O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C14H19N3O/c1-4-17-10-9-15-14(17)13(18)11-5-7-12(8-6-11)16(2)3/h5-10,13,18H,4H2,1-3H3 |
| InChIKey | UKIFMJRUEMXRCC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|