C12H14N2O5 — CID 64892164
4-[(3-aminooxolane-3-carbonyl)amino]-2-hydroxybenzoic acid (PubChem CID 64892164) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 4-[(3-aminooxolane-3-carbonyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(3-aminooxolane-3-carbonyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 64892164 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-[(3-aminooxolane-3-carbonyl)amino]-2-hydroxybenzoic acid |
| SMILES | NC1(C(=O)Nc2ccc(C(=O)O)c(O)c2)CCOC1 |
| InChI | InChI=1S/C12H14N2O5/c13-12(3-4-19-6-12)11(18)14-7-1-2-8(10(16)17)9(15)5-7/h1-2,5,15H,3-4,6,13H2,(H,14,18)(H,16,17) |
| InChIKey | PMZBHNIKIRDUKY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |