About 5,6-dihydrobenzo[b][1,4]benzoxazepine
5,6-dihydrobenzo[b][1,4]benzoxazepine (PubChem CID 648933) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 5,6-dihydrobenzo[b][1,4]benzoxazepine.
Molecular Properties
| Compound Name | 5,6-dihydrobenzo[b][1,4]benzoxazepine |
| PubChem CID | 648933 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 5,6-dihydrobenzo[b][1,4]benzoxazepine |
| SMILES | c1ccc2c(c1)CNc1ccccc1O2 |
| InChI | InChI=1S/C13H11NO/c1-3-7-12-10(5-1)9-14-11-6-2-4-8-13(11)15-12/h1-8,14H,9H2 |
| InChIKey | YUFONPPSLOZSAT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dihydrobenzo[b][1,4]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydrobenzo[b][1,4]benzoxazepine?
The IUPAC name of 5,6-dihydrobenzo[b][1,4]benzoxazepine (CID 648933) is 5,6-dihydrobenzo[b][1,4]benzoxazepine.
What is the SMILES notation for 5,6-dihydrobenzo[b][1,4]benzoxazepine?
The canonical SMILES for 5,6-dihydrobenzo[b][1,4]benzoxazepine is c1ccc2c(c1)CNc1ccccc1O2.
What is the InChIKey of 5,6-dihydrobenzo[b][1,4]benzoxazepine?
The InChIKey is YUFONPPSLOZSAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c1-3-7-12-10(5-1)9-14-11-6-2-4-8-13(11)15-12/h1-8,14H,9H2.
What are the key properties of 5,6-dihydrobenzo[b][1,4]benzoxazepine?
5,6-dihydrobenzo[b][1,4]benzoxazepine has a molecular weight of 197.24 g/mol, XLogP of 3.40, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydrobenzo[b][1,4]benzoxazepine is sourced from PubChem (CID 648933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).