About 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine
3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine (PubChem CID 64893632) has the molecular formula C8H15F3N2O
and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine.
Molecular Properties
| Compound Name | 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine |
| PubChem CID | 64893632 |
| Molecular Formula | C8H15F3N2O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine |
| SMILES | CN(CC(F)(F)F)CC1(N)CCOC1 |
| InChI | InChI=1S/C8H15F3N2O/c1-13(5-8(9,10)11)4-7(12)2-3-14-6-7/h2-6,12H2,1H3 |
| InChIKey | ISJFHLWEHQPQRA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine?
The IUPAC name of 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine (CID 64893632) is 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine.
What is the SMILES notation for 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine?
The canonical SMILES for 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine is CN(CC(F)(F)F)CC1(N)CCOC1.
What is the InChIKey of 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine?
The InChIKey is ISJFHLWEHQPQRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2O/c1-13(5-8(9,10)11)4-7(12)2-3-14-6-7/h2-6,12H2,1H3.
What are the key properties of 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine?
3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine has a molecular weight of 212.21 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine is sourced from PubChem (CID 64893632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).