C12H21N3O2 — CID 64893791
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3-aminooxolan-3-yl)methanone (PubChem CID 64893791) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3-aminooxolan-3-yl)methanone.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3-aminooxolan-3-yl)methanone |
|---|---|
| PubChem CID | 64893791 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3-aminooxolan-3-yl)methanone |
| SMILES | NC1(C(=O)N2CCN3CCCC3C2)CCOC1 |
| InChI | InChI=1S/C12H21N3O2/c13-12(3-7-17-9-12)11(16)15-6-5-14-4-1-2-10(14)8-15/h10H,1-9,13H2 |
| InChIKey | NTHJFFXIGYAHFV-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |