About 3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid
3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid (PubChem CID 64894985) has the molecular formula C9H15N3O4
and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid.
Molecular Properties
| Compound Name | 3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid |
| PubChem CID | 64894985 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid |
| SMILES | NC(CC(=O)O)C(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C9H15N3O4/c10-6(5-8(14)15)9(16)12-3-1-7(13)11-2-4-12/h6H,1-5,10H2,(H,11,13)(H,14,15) |
| InChIKey | GMBMGHQZOVLJFZ-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid?
The IUPAC name of 3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid (CID 64894985) is 3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid.
What is the SMILES notation for 3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid?
The canonical SMILES for 3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid is NC(CC(=O)O)C(=O)N1CCNC(=O)CC1.
What is the InChIKey of 3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid?
The InChIKey is GMBMGHQZOVLJFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O4/c10-6(5-8(14)15)9(16)12-3-1-7(13)11-2-4-12/h6H,1-5,10H2,(H,11,13)(H,14,15).
What are the key properties of 3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid?
3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid has a molecular weight of 229.24 g/mol, XLogP of -1.86, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-oxo-4-(5-oxo-1,4-diazepan-1-yl)butanoic acid is sourced from PubChem (CID 64894985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).