C14H22N4O3 — CID 64896517
3-amino-4-[2-(dimethylamino)ethyl-(pyridin-3-ylmethyl)amino]-4-oxobutanoic acid (PubChem CID 64896517) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 3-amino-4-[2-(dimethylamino)ethyl-(pyridin-3-ylmethyl)amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[2-(dimethylamino)ethyl-(pyridin-3-ylmethyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 64896517 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3-amino-4-[2-(dimethylamino)ethyl-(pyridin-3-ylmethyl)amino]-4-oxobutanoic acid |
| SMILES | CN(C)CCN(Cc1cccnc1)C(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C14H22N4O3/c1-17(2)6-7-18(10-11-4-3-5-16-9-11)14(21)12(15)8-13(19)20/h3-5,9,12H,6-8,10,15H2,1-2H3,(H,19,20) |
| InChIKey | GUGYVYCCKXYZIO-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |