About 6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile
6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile (PubChem CID 648966) has the molecular formula C19H19N5O2
and a molecular weight of 349.39 g/mol. Its IUPAC name is 6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile.
Molecular Properties
| Compound Name | 6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile |
| PubChem CID | 648966 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile |
| SMILES | Cc1[nH]nc2c1C1(CCN(C(=O)c3ccccc3)CC1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C19H19N5O2/c1-12-15-17(23-22-12)26-16(21)14(11-20)19(15)7-9-24(10-8-19)18(25)13-5-3-2-4-6-13/h2-6H,7-10,21H2,1H3,(H,22,23) |
| InChIKey | JCWNUCWGMSXRTB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile?
The IUPAC name of 6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile (CID 648966) is 6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile.
What is the SMILES notation for 6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile?
The canonical SMILES for 6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile is Cc1[nH]nc2c1C1(CCN(C(=O)c3ccccc3)CC1)C(C#N)=C(N)O2.
What is the InChIKey of 6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile?
The InChIKey is JCWNUCWGMSXRTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5O2/c1-12-15-17(23-22-12)26-16(21)14(11-20)19(15)7-9-24(10-8-19)18(25)13-5-3-2-4-6-13/h2-6H,7-10,21H2,1H3,(H,22,23).
What are the key properties of 6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile?
6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile has a molecular weight of 349.39 g/mol, XLogP of 1.98, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1'-benzoyl-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,4'-piperidine]-5-carbonitrile is sourced from PubChem (CID 648966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).