About N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide
N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 6489702) has the molecular formula C19H15FN2O2
and a molecular weight of 322.34 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 6489702 |
| Molecular Formula | C19H15FN2O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCC2)c1ncoc1-c1ccccc1F |
| InChI | InChI=1S/C19H15FN2O2/c20-16-7-2-1-6-15(16)18-17(21-11-24-18)19(23)22-14-9-8-12-4-3-5-13(12)10-14/h1-2,6-11H,3-5H2,(H,22,23) |
| InChIKey | KLFNXVHDQZBCTA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide?
The IUPAC name of N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide (CID 6489702) is N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide is O=C(Nc1ccc2c(c1)CCC2)c1ncoc1-c1ccccc1F.
What is the InChIKey of N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide?
The InChIKey is KLFNXVHDQZBCTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FN2O2/c20-16-7-2-1-6-15(16)18-17(21-11-24-18)19(23)22-14-9-8-12-4-3-5-13(12)10-14/h1-2,6-11H,3-5H2,(H,22,23).
What are the key properties of N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide?
N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide has a molecular weight of 322.34 g/mol, XLogP of 4.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1H-inden-5-yl)-5-(2-fluorophenyl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 6489702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).