C26H26N4O2 — CID 6489765
N-[4-(4-ethylpiperazin-1-yl)phenyl]-5-naphthalen-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 6489765) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-5-naphthalen-2-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-5-naphthalen-2-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 6489765 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-5-naphthalen-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ncoc3-c3ccc4ccccc4c3)cc2)CC1 |
| InChI | InChI=1S/C26H26N4O2/c1-2-29-13-15-30(16-14-29)23-11-9-22(10-12-23)28-26(31)24-25(32-18-27-24)21-8-7-19-5-3-4-6-20(19)17-21/h3-12,17-18H,2,13-16H2,1H3,(H,28,31) |
| InChIKey | OVOCDEHYUPQCLQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|