C12H25NO2 — CID 64898525
3-amino-2-(3,4-dimethylcyclohexyl)oxybutan-1-ol (PubChem CID 64898525) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-amino-2-(3,4-dimethylcyclohexyl)oxybutan-1-ol.
| Compound Name | 3-amino-2-(3,4-dimethylcyclohexyl)oxybutan-1-ol |
|---|---|
| PubChem CID | 64898525 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 3-amino-2-(3,4-dimethylcyclohexyl)oxybutan-1-ol |
| SMILES | CC(N)C(CO)OC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C12H25NO2/c1-8-4-5-11(6-9(8)2)15-12(7-14)10(3)13/h8-12,14H,4-7,13H2,1-3H3 |
| InChIKey | DNMCIWNKHPYWHT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |