About 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile
4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile (PubChem CID 64900052) has the molecular formula C14H11N5S
and a molecular weight of 281.34 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile.
Molecular Properties
| Compound Name | 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile |
| PubChem CID | 64900052 |
| Molecular Formula | C14H11N5S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile |
| SMILES | Cc1nc(CNc2c(C#N)nnc3ccccc23)cs1 |
| InChI | InChI=1S/C14H11N5S/c1-9-17-10(8-20-9)7-16-14-11-4-2-3-5-12(11)18-19-13(14)6-15/h2-5,8H,7H2,1H3,(H,16,18) |
| InChIKey | SNNUSQPEHFOUJR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile?
The IUPAC name of 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile (CID 64900052) is 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile.
What is the SMILES notation for 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile?
The canonical SMILES for 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile is Cc1nc(CNc2c(C#N)nnc3ccccc23)cs1.
What is the InChIKey of 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile?
The InChIKey is SNNUSQPEHFOUJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N5S/c1-9-17-10(8-20-9)7-16-14-11-4-2-3-5-12(11)18-19-13(14)6-15/h2-5,8H,7H2,1H3,(H,16,18).
What are the key properties of 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile?
4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile has a molecular weight of 281.34 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carbonitrile is sourced from PubChem (CID 64900052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).