About 3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione
3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione (PubChem CID 64901859) has the molecular formula C13H20N4O2
and a molecular weight of 264.33 g/mol. Its IUPAC name is 3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione |
| PubChem CID | 64901859 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione |
| SMILES | CCC1NC(=O)C(C)(C)N(CCn2cccn2)C1=O |
| InChI | InChI=1S/C13H20N4O2/c1-4-10-11(18)17(13(2,3)12(19)15-10)9-8-16-7-5-6-14-16/h5-7,10H,4,8-9H2,1-3H3,(H,15,19) |
| InChIKey | ZBUCUAQUMBKBRC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione?
The IUPAC name of 3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione (CID 64901859) is 3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione.
What is the SMILES notation for 3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione?
The canonical SMILES for 3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione is CCC1NC(=O)C(C)(C)N(CCn2cccn2)C1=O.
What is the InChIKey of 3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione?
The InChIKey is ZBUCUAQUMBKBRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O2/c1-4-10-11(18)17(13(2,3)12(19)15-10)9-8-16-7-5-6-14-16/h5-7,10H,4,8-9H2,1-3H3,(H,15,19).
What are the key properties of 3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione?
3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione has a molecular weight of 264.33 g/mol, XLogP of 0.40, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6,6-dimethyl-1-(2-pyrazol-1-ylethyl)piperazine-2,5-dione is sourced from PubChem (CID 64901859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).