C13H22N2O3 — CID 64902249
3,6-diethyl-6-methyl-1-(oxolan-3-yl)piperazine-2,5-dione (PubChem CID 64902249) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 3,6-diethyl-6-methyl-1-(oxolan-3-yl)piperazine-2,5-dione.
| Compound Name | 3,6-diethyl-6-methyl-1-(oxolan-3-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64902249 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 3,6-diethyl-6-methyl-1-(oxolan-3-yl)piperazine-2,5-dione |
| SMILES | CCC1NC(=O)C(C)(CC)N(C2CCOC2)C1=O |
| InChI | InChI=1S/C13H22N2O3/c1-4-10-11(16)15(9-6-7-18-8-9)13(3,5-2)12(17)14-10/h9-10H,4-8H2,1-3H3,(H,14,17) |
| InChIKey | RTDXBHKRAVYUEN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |