C18H17N3O3S3 — CID 649031
N-[4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 649031) has the molecular formula C18H17N3O3S3 and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 649031 |
| Molecular Formula | C18H17N3O3S3 |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | N-[4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | CS(=O)(=O)N1CCc2cc(-c3csc(NC(=O)Cc4cccs4)n3)ccc21 |
| InChI | InChI=1S/C18H17N3O3S3/c1-27(23,24)21-7-6-13-9-12(4-5-16(13)21)15-11-26-18(19-15)20-17(22)10-14-3-2-8-25-14/h2-5,8-9,11H,6-7,10H2,1H3,(H,19,20,22) |
| InChIKey | UDHYAXRFPGGNHA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|