About N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine
N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine (PubChem CID 64903913) has the molecular formula C13H23NO2S
and a molecular weight of 257.40 g/mol. Its IUPAC name is N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine |
| PubChem CID | 64903913 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H23NO2S/c1-2-14-13(11-6-4-3-5-7-11)12-8-9-17(15,16)10-12/h6,12-14H,2-5,7-10H2,1H3 |
| InChIKey | YPSSKGKPEBKRHP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine?
The IUPAC name of N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine (CID 64903913) is N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine.
What is the SMILES notation for N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine?
The canonical SMILES for N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine is CCNC(C1=CCCCC1)C1CCS(=O)(=O)C1.
What is the InChIKey of N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine?
The InChIKey is YPSSKGKPEBKRHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2S/c1-2-14-13(11-6-4-3-5-7-11)12-8-9-17(15,16)10-12/h6,12-14H,2-5,7-10H2,1H3.
What are the key properties of N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine?
N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine has a molecular weight of 257.40 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyclohexen-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine is sourced from PubChem (CID 64903913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).