About N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine
N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine (PubChem CID 64904122) has the molecular formula C12H21NO2S
and a molecular weight of 243.37 g/mol. Its IUPAC name is N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine |
| PubChem CID | 64904122 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H21NO2S/c1-2-13-12(10-5-3-4-6-10)11-7-8-16(14,15)9-11/h5,11-13H,2-4,6-9H2,1H3 |
| InChIKey | FLOLHTUNNDCGAH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine?
The IUPAC name of N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine (CID 64904122) is N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine.
What is the SMILES notation for N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine?
The canonical SMILES for N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine is CCNC(C1=CCCC1)C1CCS(=O)(=O)C1.
What is the InChIKey of N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine?
The InChIKey is FLOLHTUNNDCGAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2S/c1-2-13-12(10-5-3-4-6-10)11-7-8-16(14,15)9-11/h5,11-13H,2-4,6-9H2,1H3.
What are the key properties of N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine?
N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine has a molecular weight of 243.37 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyclopenten-1-yl-(1,1-dioxothiolan-3-yl)methyl]ethanamine is sourced from PubChem (CID 64904122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).