C11H16N2O5S — CID 64904149
5-[5-(1,1-dioxothiolan-3-yl)-1,3,4-oxadiazol-2-yl]pentanoic acid (PubChem CID 64904149) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is 5-[5-(1,1-dioxothiolan-3-yl)-1,3,4-oxadiazol-2-yl]pentanoic acid.
| Compound Name | 5-[5-(1,1-dioxothiolan-3-yl)-1,3,4-oxadiazol-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 64904149 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 5-[5-(1,1-dioxothiolan-3-yl)-1,3,4-oxadiazol-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nnc(C2CCS(=O)(=O)C2)o1 |
| InChI | InChI=1S/C11H16N2O5S/c14-10(15)4-2-1-3-9-12-13-11(18-9)8-5-6-19(16,17)7-8/h8H,1-7H2,(H,14,15) |
| InChIKey | QLOGILYPRQVNDT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|