C11H10ClN3O2 — CID 6490425
1-(8-chloro-4-oxo-1H-quinolin-3-yl)-3-methylurea (PubChem CID 6490425) has the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. Its IUPAC name is 1-(8-chloro-4-oxo-1H-quinolin-3-yl)-3-methylurea.
| Compound Name | 1-(8-chloro-4-oxo-1H-quinolin-3-yl)-3-methylurea |
|---|---|
| PubChem CID | 6490425 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 1-(8-chloro-4-oxo-1H-quinolin-3-yl)-3-methylurea |
| SMILES | CNC(=O)Nc1c[nH]c2c(Cl)cccc2c1=O |
| InChI | InChI=1S/C11H10ClN3O2/c1-13-11(17)15-8-5-14-9-6(10(8)16)3-2-4-7(9)12/h2-5H,1H3,(H,14,16)(H2,13,15,17) |
| InChIKey | CBRLAWTWWQGWED-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |