About 3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide
3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide (PubChem CID 64905003) has the molecular formula C13H16BrFO4S
and a molecular weight of 367.24 g/mol. Its IUPAC name is 3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide |
| PubChem CID | 64905003 |
| Molecular Formula | C13H16BrFO4S |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide |
| SMILES | COc1cc(F)c(C(Br)C2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C13H16BrFO4S/c1-18-11-5-9(10(15)6-12(11)19-2)13(14)8-3-4-20(16,17)7-8/h5-6,8,13H,3-4,7H2,1-2H3 |
| InChIKey | ZGRMQCBAECYNPY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide?
The IUPAC name of 3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide (CID 64905003) is 3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide.
What is the SMILES notation for 3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide?
The canonical SMILES for 3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide is COc1cc(F)c(C(Br)C2CCS(=O)(=O)C2)cc1OC.
What is the InChIKey of 3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide?
The InChIKey is ZGRMQCBAECYNPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrFO4S/c1-18-11-5-9(10(15)6-12(11)19-2)13(14)8-3-4-20(16,17)7-8/h5-6,8,13H,3-4,7H2,1-2H3.
What are the key properties of 3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide?
3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide has a molecular weight of 367.24 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide is sourced from PubChem (CID 64905003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).