C13H14BrNO3S — CID 64905202
5-[bromo-(1,1-dioxothiolan-3-yl)methyl]-1,3-dihydroindol-2-one (PubChem CID 64905202) has the molecular formula C13H14BrNO3S and a molecular weight of 344.23 g/mol. Its IUPAC name is 5-[bromo-(1,1-dioxothiolan-3-yl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[bromo-(1,1-dioxothiolan-3-yl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 64905202 |
| Molecular Formula | C13H14BrNO3S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 5-[bromo-(1,1-dioxothiolan-3-yl)methyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Br)C3CCS(=O)(=O)C3)ccc2N1 |
| InChI | InChI=1S/C13H14BrNO3S/c14-13(9-3-4-19(17,18)7-9)8-1-2-11-10(5-8)6-12(16)15-11/h1-2,5,9,13H,3-4,6-7H2,(H,15,16) |
| InChIKey | VAYHNIYHNIJYGK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|