C14H20FNO2S — CID 64905384
1-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(4-fluorophenyl)ethanamine (PubChem CID 64905384) has the molecular formula C14H20FNO2S and a molecular weight of 285.38 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(4-fluorophenyl)ethanamine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 64905384 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(4-fluorophenyl)ethanamine |
| SMILES | CCNC(Cc1ccc(F)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H20FNO2S/c1-2-16-14(12-7-8-19(17,18)10-12)9-11-3-5-13(15)6-4-11/h3-6,12,14,16H,2,7-10H2,1H3 |
| InChIKey | IUUHTRGTQURMJA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |