About 3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine
3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine (PubChem CID 64905520) has the molecular formula C9H19NOS
and a molecular weight of 189.32 g/mol. Its IUPAC name is 3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine.
Molecular Properties
| Compound Name | 3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine |
| PubChem CID | 64905520 |
| Molecular Formula | C9H19NOS |
| Molecular Weight | 189.32 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine |
| SMILES | CCS(=O)C1CCC(NC)C1C |
| InChI | InChI=1S/C9H19NOS/c1-4-12(11)9-6-5-8(10-3)7(9)2/h7-10H,4-6H2,1-3H3 |
| InChIKey | AJNNPFCXNZKDOX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine?
The IUPAC name of 3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine (CID 64905520) is 3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine.
What is the SMILES notation for 3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine?
The canonical SMILES for 3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine is CCS(=O)C1CCC(NC)C1C.
What is the InChIKey of 3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine?
The InChIKey is AJNNPFCXNZKDOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NOS/c1-4-12(11)9-6-5-8(10-3)7(9)2/h7-10H,4-6H2,1-3H3.
What are the key properties of 3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine?
3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine has a molecular weight of 189.32 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfinyl-N,2-dimethylcyclopentan-1-amine is sourced from PubChem (CID 64905520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).