C11H13N3O3S2 — CID 64905803
N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 64905803) has the molecular formula C11H13N3O3S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 64905803 |
| Molecular Formula | C11H13N3O3S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | NCC#Cc1cnc(NC(=O)C2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C11H13N3O3S2/c12-4-1-2-9-6-13-11(18-9)14-10(15)8-3-5-19(16,17)7-8/h6,8H,3-5,7,12H2,(H,13,14,15) |
| InChIKey | VZPABALLTQPZHD-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|