C16H18N2 — CID 64906503
3-(2-methylbut-3-yn-2-ylamino)-1-phenylcyclobutane-1-carbonitrile (PubChem CID 64906503) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-(2-methylbut-3-yn-2-ylamino)-1-phenylcyclobutane-1-carbonitrile.
| Compound Name | 3-(2-methylbut-3-yn-2-ylamino)-1-phenylcyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 64906503 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 3-(2-methylbut-3-yn-2-ylamino)-1-phenylcyclobutane-1-carbonitrile |
| SMILES | C#CC(C)(C)NC1CC(C#N)(c2ccccc2)C1 |
| InChI | InChI=1S/C16H18N2/c1-4-15(2,3)18-14-10-16(11-14,12-17)13-8-6-5-7-9-13/h1,5-9,14,18H,10-11H2,2-3H3 |
| InChIKey | KMYPEPLXVRMECO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|