C14H19F2N — CID 64908994
3-(3,5-difluorophenyl)-N-ethyl-2-methylcyclopentan-1-amine (PubChem CID 64908994) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-N-ethyl-2-methylcyclopentan-1-amine.
| Compound Name | 3-(3,5-difluorophenyl)-N-ethyl-2-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 64908994 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-(3,5-difluorophenyl)-N-ethyl-2-methylcyclopentan-1-amine |
| SMILES | CCNC1CCC(c2cc(F)cc(F)c2)C1C |
| InChI | InChI=1S/C14H19F2N/c1-3-17-14-5-4-13(9(14)2)10-6-11(15)8-12(16)7-10/h6-9,13-14,17H,3-5H2,1-2H3 |
| InChIKey | FJGSKJXPEPCTLD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |