About 4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene
4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene (PubChem CID 64909036) has the molecular formula C12H13BrCl2
and a molecular weight of 308.05 g/mol. Its IUPAC name is 4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene.
Molecular Properties
| Compound Name | 4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene |
| PubChem CID | 64909036 |
| Molecular Formula | C12H13BrCl2 |
| Molecular Weight | 308.05 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene |
| SMILES | CC1C(Br)CCC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13BrCl2/c1-7-9(3-4-10(7)13)8-2-5-11(14)12(15)6-8/h2,5-7,9-10H,3-4H2,1H3 |
| InChIKey | IXGLHELFSAAAJZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.05 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene?
The IUPAC name of 4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene (CID 64909036) is 4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene.
What is the SMILES notation for 4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene?
The canonical SMILES for 4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene is CC1C(Br)CCC1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene?
The InChIKey is IXGLHELFSAAAJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrCl2/c1-7-9(3-4-10(7)13)8-2-5-11(14)12(15)6-8/h2,5-7,9-10H,3-4H2,1H3.
What are the key properties of 4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene?
4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene has a molecular weight of 308.05 g/mol, XLogP of 5.27, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromo-2-methylcyclopentyl)-1,2-dichlorobenzene is sourced from PubChem (CID 64909036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).