C10H20N2O — CID 64909126
2-amino-N-(2,3-dimethylcyclopentyl)propanamide (PubChem CID 64909126) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-amino-N-(2,3-dimethylcyclopentyl)propanamide.
| Compound Name | 2-amino-N-(2,3-dimethylcyclopentyl)propanamide |
|---|---|
| PubChem CID | 64909126 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-amino-N-(2,3-dimethylcyclopentyl)propanamide |
| SMILES | CC(N)C(=O)NC1CCC(C)C1C |
| InChI | InChI=1S/C10H20N2O/c1-6-4-5-9(7(6)2)12-10(13)8(3)11/h6-9H,4-5,11H2,1-3H3,(H,12,13) |
| InChIKey | VPYQLTCUTJMVQD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |