About N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide
N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide (PubChem CID 6490916) has the molecular formula C18H22N2O4
and a molecular weight of 330.38 g/mol. Its IUPAC name is N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide |
| PubChem CID | 6490916 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide |
| SMILES | Cc1ccc(OCC(=O)NCCCNC(=O)c2ccco2)cc1C |
| InChI | InChI=1S/C18H22N2O4/c1-13-6-7-15(11-14(13)2)24-12-17(21)19-8-4-9-20-18(22)16-5-3-10-23-16/h3,5-7,10-11H,4,8-9,12H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | VWVUEVKBJFDYDT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide?
The IUPAC name of N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide (CID 6490916) is N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide.
What is the SMILES notation for N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide?
The canonical SMILES for N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide is Cc1ccc(OCC(=O)NCCCNC(=O)c2ccco2)cc1C.
What is the InChIKey of N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide?
The InChIKey is VWVUEVKBJFDYDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O4/c1-13-6-7-15(11-14(13)2)24-12-17(21)19-8-4-9-20-18(22)16-5-3-10-23-16/h3,5-7,10-11H,4,8-9,12H2,1-2H3,(H,19,21)(H,20,22).
What are the key properties of N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide?
N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide has a molecular weight of 330.38 g/mol, XLogP of 2.21, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]furan-2-carboxamide is sourced from PubChem (CID 6490916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).