About N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide
N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide (PubChem CID 6490918) has the molecular formula C19H23N3O3
and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide |
| PubChem CID | 6490918 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(OCC(=O)NCCCNC(=O)c2cccnc2)cc1C |
| InChI | InChI=1S/C19H23N3O3/c1-14-6-7-17(11-15(14)2)25-13-18(23)21-9-4-10-22-19(24)16-5-3-8-20-12-16/h3,5-8,11-12H,4,9-10,13H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | AXFCROGJKRFMIF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide?
The IUPAC name of N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide (CID 6490918) is N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide.
What is the SMILES notation for N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide?
The canonical SMILES for N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide is Cc1ccc(OCC(=O)NCCCNC(=O)c2cccnc2)cc1C.
What is the InChIKey of N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide?
The InChIKey is AXFCROGJKRFMIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O3/c1-14-6-7-17(11-15(14)2)25-13-18(23)21-9-4-10-22-19(24)16-5-3-8-20-12-16/h3,5-8,11-12H,4,9-10,13H2,1-2H3,(H,21,23)(H,22,24).
What are the key properties of N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide?
N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide has a molecular weight of 341.41 g/mol, XLogP of 2.01, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]propyl]pyridine-3-carboxamide is sourced from PubChem (CID 6490918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).