C14H18O2S — CID 64909608
3-(2,4-dimethylphenyl)sulfinyl-2-methylcyclopentan-1-one (PubChem CID 64909608) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)sulfinyl-2-methylcyclopentan-1-one.
| Compound Name | 3-(2,4-dimethylphenyl)sulfinyl-2-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 64909608 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-(2,4-dimethylphenyl)sulfinyl-2-methylcyclopentan-1-one |
| SMILES | Cc1ccc(S(=O)C2CCC(=O)C2C)c(C)c1 |
| InChI | InChI=1S/C14H18O2S/c1-9-4-6-13(10(2)8-9)17(16)14-7-5-12(15)11(14)3/h4,6,8,11,14H,5,7H2,1-3H3 |
| InChIKey | IRPUJFZSAMJVOQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |